C13H12ClN3O3 — CID 114406135
5-amino-6-(2-chloro-5-methoxyanilino)pyridine-2-carboxylic acid (PubChem CID 114406135) has the molecular formula C13H12ClN3O3 and a molecular weight of 293.71 g/mol. Its IUPAC name is 5-amino-6-(2-chloro-5-methoxyanilino)pyridine-2-carboxylic acid.
| Compound Name | 5-amino-6-(2-chloro-5-methoxyanilino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 114406135 |
| Molecular Formula | C13H12ClN3O3 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 5-amino-6-(2-chloro-5-methoxyanilino)pyridine-2-carboxylic acid |
| SMILES | COc1ccc(Cl)c(Nc2nc(C(=O)O)ccc2N)c1 |
| InChI | InChI=1S/C13H12ClN3O3/c1-20-7-2-3-8(14)11(6-7)17-12-9(15)4-5-10(16-12)13(18)19/h2-6H,15H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | ULLYGHUZMCJGMW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |