C13H6Cl5NO3 — CID 134631383
6-methoxy-5-(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylic acid (PubChem CID 134631383) has the molecular formula C13H6Cl5NO3 and a molecular weight of 401.46 g/mol. Its IUPAC name is 6-methoxy-5-(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylic acid.
| Compound Name | 6-methoxy-5-(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 134631383 |
| Molecular Formula | C13H6Cl5NO3 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 398.88 |
| IUPAC Name | 6-methoxy-5-(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylic acid |
| SMILES | COc1nc(C(=O)O)ccc1-c1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H6Cl5NO3/c1-22-12-4(2-3-5(19-12)13(20)21)6-7(14)9(16)11(18)10(17)8(6)15/h2-3H,1H3,(H,20,21) |
| InChIKey | PPTNFQGDWSZWBR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|