C9H9NO5 — CID 91509956
6-methoxy-4-methylpyridine-2,5-dicarboxylic acid (PubChem CID 91509956) has the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. Its IUPAC name is 6-methoxy-4-methylpyridine-2,5-dicarboxylic acid.
| Compound Name | 6-methoxy-4-methylpyridine-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 91509956 |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 6-methoxy-4-methylpyridine-2,5-dicarboxylic acid |
| SMILES | COc1nc(C(=O)O)cc(C)c1C(=O)O |
| InChI | InChI=1S/C9H9NO5/c1-4-3-5(8(11)12)10-7(15-2)6(4)9(13)14/h3H,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | AJIHCLYPJNUFBE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |