5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid

C8H5F2NO5 — CID 23233931

IUPAC5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid
SMILESCOc1nc(F)c(F)c(C(=O)O)c1C(=O)O
InChIInChI=1S/C8H5F2NO5/c1-16-6-3(8(14)15)2(7(12)13)4(9)5(10)11-6/h1H3,(H,12,13)(H,14,15)
InChIKeyUYQBQDRBDQYOAX-UHFFFAOYSA-N
MW233.13 g/mol
LogP0.76
Rot. Bonds3

About 5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid

5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid (PubChem CID 23233931) has the molecular formula C8H5F2NO5 and a molecular weight of 233.13 g/mol. Its IUPAC name is 5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid.

Molecular Properties

Compound Name5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid
PubChem CID23233931
Molecular FormulaC8H5F2NO5
Molecular Weight233.13 g/mol
Exact Mass233.01
IUPAC Name5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid
SMILESCOc1nc(F)c(F)c(C(=O)O)c1C(=O)O
InChIInChI=1S/C8H5F2NO5/c1-16-6-3(8(14)15)2(7(12)13)4(9)5(10)11-6/h1H3,(H,12,13)(H,14,15)
InChIKeyUYQBQDRBDQYOAX-UHFFFAOYSA-N
XLogP0.76
TPSA96.72 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.13
LogP ≤ 50.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid?
The IUPAC name of 5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid (CID 23233931) is 5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid.
What is the SMILES notation for 5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid?
The canonical SMILES for 5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid is COc1nc(F)c(F)c(C(=O)O)c1C(=O)O.
What is the InChIKey of 5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid?
The InChIKey is UYQBQDRBDQYOAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2NO5/c1-16-6-3(8(14)15)2(7(12)13)4(9)5(10)11-6/h1H3,(H,12,13)(H,14,15).
What are the key properties of 5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid?
5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid has a molecular weight of 233.13 g/mol, XLogP of 0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-2-methoxypyridine-3,4-dicarboxylic acid is sourced from PubChem (CID 23233931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).