C7H7ClN2O3 — CID 70318637
6-amino-4-chloro-2-methoxypyridine-3-carboxylic acid (PubChem CID 70318637) has the molecular formula C7H7ClN2O3 and a molecular weight of 202.60 g/mol. Its IUPAC name is 6-amino-4-chloro-2-methoxypyridine-3-carboxylic acid.
| Compound Name | 6-amino-4-chloro-2-methoxypyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70318637 |
| Molecular Formula | C7H7ClN2O3 |
| Molecular Weight | 202.60 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 6-amino-4-chloro-2-methoxypyridine-3-carboxylic acid |
| SMILES | COc1nc(N)cc(Cl)c1C(=O)O |
| InChI | InChI=1S/C7H7ClN2O3/c1-13-6-5(7(11)12)3(8)2-4(9)10-6/h2H,1H3,(H2,9,10)(H,11,12) |
| InChIKey | XMVBSSNWADJDFE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.60 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |