C14H10Cl3NO3 — CID 134636431
2-[6-methoxy-5-(2,4,6-trichlorophenyl)-2-pyridinyl]acetic acid (PubChem CID 134636431) has the molecular formula C14H10Cl3NO3 and a molecular weight of 346.60 g/mol. Its IUPAC name is 2-[6-methoxy-5-(2,4,6-trichlorophenyl)-2-pyridinyl]acetic acid.
| Compound Name | 2-[6-methoxy-5-(2,4,6-trichlorophenyl)-2-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 134636431 |
| Molecular Formula | C14H10Cl3NO3 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 344.97 |
| IUPAC Name | 2-[6-methoxy-5-(2,4,6-trichlorophenyl)-2-pyridinyl]acetic acid |
| SMILES | COc1nc(CC(=O)O)ccc1-c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl3NO3/c1-21-14-9(3-2-8(18-14)6-12(19)20)13-10(16)4-7(15)5-11(13)17/h2-5H,6H2,1H3,(H,19,20) |
| InChIKey | SHDOGHDGNCOLBW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |