C13H10Cl3NO2 — CID 134636475
[6-methoxy-3-(2,4,6-trichlorophenyl)-2-pyridinyl]methanol (PubChem CID 134636475) has the molecular formula C13H10Cl3NO2 and a molecular weight of 318.59 g/mol. Its IUPAC name is [6-methoxy-3-(2,4,6-trichlorophenyl)-2-pyridinyl]methanol.
| Compound Name | [6-methoxy-3-(2,4,6-trichlorophenyl)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 134636475 |
| Molecular Formula | C13H10Cl3NO2 |
| Molecular Weight | 318.59 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | [6-methoxy-3-(2,4,6-trichlorophenyl)-2-pyridinyl]methanol |
| SMILES | COc1ccc(-c2c(Cl)cc(Cl)cc2Cl)c(CO)n1 |
| InChI | InChI=1S/C13H10Cl3NO2/c1-19-12-3-2-8(11(6-18)17-12)13-9(15)4-7(14)5-10(13)16/h2-5,18H,6H2,1H3 |
| InChIKey | VXJZEYWBERTURY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |