C18H21NO5 — CID 165341079
methyl 3-[3-[2-(hydroxymethyl)-6-methoxy-3-pyridinyl]-4-methoxyphenyl]propanoate (PubChem CID 165341079) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is methyl 3-[3-[2-(hydroxymethyl)-6-methoxy-3-pyridinyl]-4-methoxyphenyl]propanoate.
| Compound Name | methyl 3-[3-[2-(hydroxymethyl)-6-methoxy-3-pyridinyl]-4-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 165341079 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | methyl 3-[3-[2-(hydroxymethyl)-6-methoxy-3-pyridinyl]-4-methoxyphenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OC)c(-c2ccc(OC)nc2CO)c1 |
| InChI | InChI=1S/C18H21NO5/c1-22-16-7-4-12(5-9-18(21)24-3)10-14(16)13-6-8-17(23-2)19-15(13)11-20/h4,6-8,10,20H,5,9,11H2,1-3H3 |
| InChIKey | XBCZLNOMQHPIFS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |