C16H15ClO3 — CID 70423773
methyl 3-[3-(4-chlorophenyl)-4-hydroxyphenyl]propanoate (PubChem CID 70423773) has the molecular formula C16H15ClO3 and a molecular weight of 290.75 g/mol. Its IUPAC name is methyl 3-[3-(4-chlorophenyl)-4-hydroxyphenyl]propanoate.
| Compound Name | methyl 3-[3-(4-chlorophenyl)-4-hydroxyphenyl]propanoate |
|---|---|
| PubChem CID | 70423773 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | methyl 3-[3-(4-chlorophenyl)-4-hydroxyphenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(O)c(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H15ClO3/c1-20-16(19)9-3-11-2-8-15(18)14(10-11)12-4-6-13(17)7-5-12/h2,4-8,10,18H,3,9H2,1H3 |
| InChIKey | TZHLJNLJFBCLKQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |