C20H17ClO3 — CID 22558879
methyl 3-(3-chloro-4-hydroxy-5-naphthalen-2-ylphenyl)propanoate (PubChem CID 22558879) has the molecular formula C20H17ClO3 and a molecular weight of 340.81 g/mol. Its IUPAC name is methyl 3-(3-chloro-4-hydroxy-5-naphthalen-2-ylphenyl)propanoate.
| Compound Name | methyl 3-(3-chloro-4-hydroxy-5-naphthalen-2-ylphenyl)propanoate |
|---|---|
| PubChem CID | 22558879 |
| Molecular Formula | C20H17ClO3 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | methyl 3-(3-chloro-4-hydroxy-5-naphthalen-2-ylphenyl)propanoate |
| SMILES | COC(=O)CCc1cc(Cl)c(O)c(-c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C20H17ClO3/c1-24-19(22)9-6-13-10-17(20(23)18(21)11-13)16-8-7-14-4-2-3-5-15(14)12-16/h2-5,7-8,10-12,23H,6,9H2,1H3 |
| InChIKey | QQUXTJQGIZQYST-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |