C20H18O3 — CID 22559255
3-(4-methoxy-3-naphthalen-2-ylphenyl)propanoic acid (PubChem CID 22559255) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-(4-methoxy-3-naphthalen-2-ylphenyl)propanoic acid.
| Compound Name | 3-(4-methoxy-3-naphthalen-2-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 22559255 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3-(4-methoxy-3-naphthalen-2-ylphenyl)propanoic acid |
| SMILES | COc1ccc(CCC(=O)O)cc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H18O3/c1-23-19-10-6-14(7-11-20(21)22)12-18(19)17-9-8-15-4-2-3-5-16(15)13-17/h2-6,8-10,12-13H,7,11H2,1H3,(H,21,22) |
| InChIKey | KLSVYQHAUQZTKC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |