C30H30N2O3S — CID 87890024
3-[4-[2-[(2-ethylphenyl)carbamothioylamino]ethoxy]-3-naphthalen-2-ylphenyl]propanoic acid (PubChem CID 87890024) has the molecular formula C30H30N2O3S and a molecular weight of 498.65 g/mol. Its IUPAC name is 3-[4-[2-[(2-ethylphenyl)carbamothioylamino]ethoxy]-3-naphthalen-2-ylphenyl]propanoic acid.
| Compound Name | 3-[4-[2-[(2-ethylphenyl)carbamothioylamino]ethoxy]-3-naphthalen-2-ylphenyl]propanoic acid |
|---|---|
| PubChem CID | 87890024 |
| Molecular Formula | C30H30N2O3S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 3-[4-[2-[(2-ethylphenyl)carbamothioylamino]ethoxy]-3-naphthalen-2-ylphenyl]propanoic acid |
| SMILES | CCc1ccccc1NC(=S)NCCOc1ccc(CCC(=O)O)cc1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H30N2O3S/c1-2-22-7-5-6-10-27(22)32-30(36)31-17-18-35-28-15-11-21(12-16-29(33)34)19-26(28)25-14-13-23-8-3-4-9-24(23)20-25/h3-11,13-15,19-20H,2,12,16-18H2,1H3,(H,33,34)(H2,31,32,36) |
| InChIKey | DGOKETCDIRLLNS-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|