C29H29NO5S — CID 68741250
methyl 3-[4-[2-(N-methylsulfonylanilino)ethoxy]-3-naphthalen-2-ylphenyl]propanoate (PubChem CID 68741250) has the molecular formula C29H29NO5S and a molecular weight of 503.62 g/mol. Its IUPAC name is methyl 3-[4-[2-(N-methylsulfonylanilino)ethoxy]-3-naphthalen-2-ylphenyl]propanoate.
| Compound Name | methyl 3-[4-[2-(N-methylsulfonylanilino)ethoxy]-3-naphthalen-2-ylphenyl]propanoate |
|---|---|
| PubChem CID | 68741250 |
| Molecular Formula | C29H29NO5S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | methyl 3-[4-[2-(N-methylsulfonylanilino)ethoxy]-3-naphthalen-2-ylphenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCCN(c2ccccc2)S(C)(=O)=O)c(-c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C29H29NO5S/c1-34-29(31)17-13-22-12-16-28(27(20-22)25-15-14-23-8-6-7-9-24(23)21-25)35-19-18-30(36(2,32)33)26-10-4-3-5-11-26/h3-12,14-16,20-21H,13,17-19H2,1-2H3 |
| InChIKey | VPBOHFZBVWNRNY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |