C27H31NO3 — CID 22559030
methyl 3-[4-(cyclopentylmethoxy)-3-[6-(methylamino)naphthalen-2-yl]phenyl]propanoate (PubChem CID 22559030) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is methyl 3-[4-(cyclopentylmethoxy)-3-[6-(methylamino)naphthalen-2-yl]phenyl]propanoate.
| Compound Name | methyl 3-[4-(cyclopentylmethoxy)-3-[6-(methylamino)naphthalen-2-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 22559030 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | methyl 3-[4-(cyclopentylmethoxy)-3-[6-(methylamino)naphthalen-2-yl]phenyl]propanoate |
| SMILES | CNc1ccc2cc(-c3cc(CCC(=O)OC)ccc3OCC3CCCC3)ccc2c1 |
| InChI | InChI=1S/C27H31NO3/c1-28-24-12-11-21-16-23(10-9-22(21)17-24)25-15-19(8-14-27(29)30-2)7-13-26(25)31-18-20-5-3-4-6-20/h7,9-13,15-17,20,28H,3-6,8,14,18H2,1-2H3 |
| InChIKey | UYNHOWWCOFJBFI-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |