C27H28O5 — CID 22558817
6-[5-(2-carboxyethyl)-2-(cyclohexylmethoxy)phenyl]naphthalene-2-carboxylic acid (PubChem CID 22558817) has the molecular formula C27H28O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 6-[5-(2-carboxyethyl)-2-(cyclohexylmethoxy)phenyl]naphthalene-2-carboxylic acid.
| Compound Name | 6-[5-(2-carboxyethyl)-2-(cyclohexylmethoxy)phenyl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 22558817 |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 6-[5-(2-carboxyethyl)-2-(cyclohexylmethoxy)phenyl]naphthalene-2-carboxylic acid |
| SMILES | O=C(O)CCc1ccc(OCC2CCCCC2)c(-c2ccc3cc(C(=O)O)ccc3c2)c1 |
| InChI | InChI=1S/C27H28O5/c28-26(29)13-7-18-6-12-25(32-17-19-4-2-1-3-5-19)24(14-18)22-10-8-21-16-23(27(30)31)11-9-20(21)15-22/h6,8-12,14-16,19H,1-5,7,13,17H2,(H,28,29)(H,30,31) |
| InChIKey | QVPKJWDIVIXYIY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |