C27H31NO3 — CID 68826339
3-[4-(cyclopentylmethoxy)-3-[6-(methylamino)naphthalen-2-yl]phenyl]-2-methylpropanoic acid (PubChem CID 68826339) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 3-[4-(cyclopentylmethoxy)-3-[6-(methylamino)naphthalen-2-yl]phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[4-(cyclopentylmethoxy)-3-[6-(methylamino)naphthalen-2-yl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68826339 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 3-[4-(cyclopentylmethoxy)-3-[6-(methylamino)naphthalen-2-yl]phenyl]-2-methylpropanoic acid |
| SMILES | CNc1ccc2cc(-c3cc(CC(C)C(=O)O)ccc3OCC3CCCC3)ccc2c1 |
| InChI | InChI=1S/C27H31NO3/c1-18(27(29)30)13-20-7-12-26(31-17-19-5-3-4-6-19)25(14-20)23-9-8-22-16-24(28-2)11-10-21(22)15-23/h7-12,14-16,18-19,28H,3-6,13,17H2,1-2H3,(H,29,30) |
| InChIKey | XFIONWZDNAXRJY-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |