C26H25NO3S — CID 68825360
3-[3-(1H-indol-5-yl)-4-(2-phenylsulfanylethoxy)phenyl]-2-methylpropanoic acid (PubChem CID 68825360) has the molecular formula C26H25NO3S and a molecular weight of 431.56 g/mol. Its IUPAC name is 3-[3-(1H-indol-5-yl)-4-(2-phenylsulfanylethoxy)phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[3-(1H-indol-5-yl)-4-(2-phenylsulfanylethoxy)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 68825360 |
| Molecular Formula | C26H25NO3S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3-[3-(1H-indol-5-yl)-4-(2-phenylsulfanylethoxy)phenyl]-2-methylpropanoic acid |
| SMILES | CC(Cc1ccc(OCCSc2ccccc2)c(-c2ccc3[nH]ccc3c2)c1)C(=O)O |
| InChI | InChI=1S/C26H25NO3S/c1-18(26(28)29)15-19-7-10-25(30-13-14-31-22-5-3-2-4-6-22)23(16-19)20-8-9-24-21(17-20)11-12-27-24/h2-12,16-18,27H,13-15H2,1H3,(H,28,29) |
| InChIKey | HQIAVIRAHXGNEZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|