C22H28O3 — CID 174337519
2-methyl-4-(4-pentoxy-3-phenylphenyl)butanoic acid (PubChem CID 174337519) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 2-methyl-4-(4-pentoxy-3-phenylphenyl)butanoic acid.
| Compound Name | 2-methyl-4-(4-pentoxy-3-phenylphenyl)butanoic acid |
|---|---|
| PubChem CID | 174337519 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 2-methyl-4-(4-pentoxy-3-phenylphenyl)butanoic acid |
| SMILES | CCCCCOc1ccc(CCC(C)C(=O)O)cc1-c1ccccc1 |
| InChI | InChI=1S/C22H28O3/c1-3-4-8-15-25-21-14-13-18(12-11-17(2)22(23)24)16-20(21)19-9-6-5-7-10-19/h5-7,9-10,13-14,16-17H,3-4,8,11-12,15H2,1-2H3,(H,23,24) |
| InChIKey | MAZPSLLFZJISEM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|