C27H28F2O4 — CID 94036766
(2S)-4-[4-[4-[4-(2,4-difluorophenyl)phenoxy]butoxy]phenyl]-2-methylbutanoic acid (PubChem CID 94036766) has the molecular formula C27H28F2O4 and a molecular weight of 454.51 g/mol. Its IUPAC name is (2S)-4-[4-[4-[4-(2,4-difluorophenyl)phenoxy]butoxy]phenyl]-2-methylbutanoic acid.
| Compound Name | (2S)-4-[4-[4-[4-(2,4-difluorophenyl)phenoxy]butoxy]phenyl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 94036766 |
| Molecular Formula | C27H28F2O4 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (2S)-4-[4-[4-[4-(2,4-difluorophenyl)phenoxy]butoxy]phenyl]-2-methylbutanoic acid |
| SMILES | C[C@@H](CCc1ccc(OCCCCOc2ccc(-c3ccc(F)cc3F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H28F2O4/c1-19(27(30)31)4-5-20-6-11-23(12-7-20)32-16-2-3-17-33-24-13-8-21(9-14-24)25-15-10-22(28)18-26(25)29/h6-15,18-19H,2-5,16-17H2,1H3,(H,30,31)/t19-/m0/s1 |
| InChIKey | ZFEWTSRQJVGNAL-IBGZPJMESA-N |
| XLogP | 6.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|