C25H32O6 — CID 54012776
3-[3-[5-(2-carboxyethyl)-2-heptoxyphenyl]-4-hydroxyphenyl]propanoic acid (PubChem CID 54012776) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is 3-[3-[5-(2-carboxyethyl)-2-heptoxyphenyl]-4-hydroxyphenyl]propanoic acid.
| Compound Name | 3-[3-[5-(2-carboxyethyl)-2-heptoxyphenyl]-4-hydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 54012776 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 3-[3-[5-(2-carboxyethyl)-2-heptoxyphenyl]-4-hydroxyphenyl]propanoic acid |
| SMILES | CCCCCCCOc1ccc(CCC(=O)O)cc1-c1cc(CCC(=O)O)ccc1O |
| InChI | InChI=1S/C25H32O6/c1-2-3-4-5-6-15-31-23-12-8-19(10-14-25(29)30)17-21(23)20-16-18(7-11-22(20)26)9-13-24(27)28/h7-8,11-12,16-17,26H,2-6,9-10,13-15H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | KTNQWXZHUDFZND-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|