C26H36O8 — CID 161403308
3-(4-hydroxy-3-methoxyphenyl)propanoic acid;propyl 3-(3-methoxy-4-propoxyphenyl)propanoate (PubChem CID 161403308) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is 3-(4-hydroxy-3-methoxyphenyl)propanoic acid;propyl 3-(3-methoxy-4-propoxyphenyl)propanoate.
| Compound Name | 3-(4-hydroxy-3-methoxyphenyl)propanoic acid;propyl 3-(3-methoxy-4-propoxyphenyl)propanoate |
|---|---|
| PubChem CID | 161403308 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 3-(4-hydroxy-3-methoxyphenyl)propanoic acid;propyl 3-(3-methoxy-4-propoxyphenyl)propanoate |
| SMILES | CCCOC(=O)CCc1ccc(OCCC)c(OC)c1.COc1cc(CCC(=O)O)ccc1O |
| InChI | InChI=1S/C16H24O4.C10H12O4/c1-4-10-19-14-8-6-13(12-15(14)18-3)7-9-16(17)20-11-5-2;1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h6,8,12H,4-5,7,9-11H2,1-3H3;2,4,6,11H,3,5H2,1H3,(H,12,13) |
| InChIKey | VUMYJQLFKNORQM-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |