C17H24O6 — CID 19921940
3-[3-(2-carboxyethyl)-4-(5-hydroxypentoxy)phenyl]propanoic acid (PubChem CID 19921940) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is 3-[3-(2-carboxyethyl)-4-(5-hydroxypentoxy)phenyl]propanoic acid.
| Compound Name | 3-[3-(2-carboxyethyl)-4-(5-hydroxypentoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 19921940 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-[3-(2-carboxyethyl)-4-(5-hydroxypentoxy)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCCCCCO)c(CCC(=O)O)c1 |
| InChI | InChI=1S/C17H24O6/c18-10-2-1-3-11-23-15-7-4-13(5-8-16(19)20)12-14(15)6-9-17(21)22/h4,7,12,18H,1-3,5-6,8-11H2,(H,19,20)(H,21,22) |
| InChIKey | DAADRQZEMUVJCK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|