C13H19NO3 — CID 82152584
3-(3-amino-4-butoxyphenyl)propanoic acid (PubChem CID 82152584) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(3-amino-4-butoxyphenyl)propanoic acid.
| Compound Name | 3-(3-amino-4-butoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 82152584 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 3-(3-amino-4-butoxyphenyl)propanoic acid |
| SMILES | CCCCOc1ccc(CCC(=O)O)cc1N |
| InChI | InChI=1S/C13H19NO3/c1-2-3-8-17-12-6-4-10(9-11(12)14)5-7-13(15)16/h4,6,9H,2-3,5,7-8,14H2,1H3,(H,15,16) |
| InChIKey | WKNZMHKQNJUBSU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|