C32H29NO3S — CID 142669630
methyl 3-[2-[3-(1H-indol-5-yl)phenyl]-4-(2-phenylsulfanylethoxy)phenyl]propanoate (PubChem CID 142669630) has the molecular formula C32H29NO3S and a molecular weight of 507.66 g/mol. Its IUPAC name is methyl 3-[2-[3-(1H-indol-5-yl)phenyl]-4-(2-phenylsulfanylethoxy)phenyl]propanoate.
| Compound Name | methyl 3-[2-[3-(1H-indol-5-yl)phenyl]-4-(2-phenylsulfanylethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 142669630 |
| Molecular Formula | C32H29NO3S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | methyl 3-[2-[3-(1H-indol-5-yl)phenyl]-4-(2-phenylsulfanylethoxy)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCCSc2ccccc2)cc1-c1cccc(-c2ccc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C32H29NO3S/c1-35-32(34)15-12-23-10-13-28(36-18-19-37-29-8-3-2-4-9-29)22-30(23)26-7-5-6-24(20-26)25-11-14-31-27(21-25)16-17-33-31/h2-11,13-14,16-17,20-22,33H,12,15,18-19H2,1H3 |
| InChIKey | IDSXFIUGWUPPLO-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|