About methyl 2-(1H-indol-5-yl)acetate
methyl 2-(1H-indol-5-yl)acetate (PubChem CID 43831379) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is methyl 2-(1H-indol-5-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(1H-indol-5-yl)acetate |
| PubChem CID | 43831379 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | methyl 2-(1H-indol-5-yl)acetate |
| SMILES | COC(=O)Cc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C11H11NO2/c1-14-11(13)7-8-2-3-10-9(6-8)4-5-12-10/h2-6,12H,7H2,1H3 |
| InChIKey | ZWPPJBSFGQAVEQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-(1H-indol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1H-indol-5-yl)acetate?
The IUPAC name of methyl 2-(1H-indol-5-yl)acetate (CID 43831379) is methyl 2-(1H-indol-5-yl)acetate.
What is the SMILES notation for methyl 2-(1H-indol-5-yl)acetate?
The canonical SMILES for methyl 2-(1H-indol-5-yl)acetate is COC(=O)Cc1ccc2[nH]ccc2c1.
What is the InChIKey of methyl 2-(1H-indol-5-yl)acetate?
The InChIKey is ZWPPJBSFGQAVEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-14-11(13)7-8-2-3-10-9(6-8)4-5-12-10/h2-6,12H,7H2,1H3.
What are the key properties of methyl 2-(1H-indol-5-yl)acetate?
methyl 2-(1H-indol-5-yl)acetate has a molecular weight of 189.21 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1H-indol-5-yl)acetate is sourced from PubChem (CID 43831379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).