C15H14N4O2 — CID 68638504
2-(1H-indol-5-yl)-N-(6-methoxypyridazin-3-yl)acetamide (PubChem CID 68638504) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-(1H-indol-5-yl)-N-(6-methoxypyridazin-3-yl)acetamide.
| Compound Name | 2-(1H-indol-5-yl)-N-(6-methoxypyridazin-3-yl)acetamide |
|---|---|
| PubChem CID | 68638504 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-(1H-indol-5-yl)-N-(6-methoxypyridazin-3-yl)acetamide |
| SMILES | COc1ccc(NC(=O)Cc2ccc3[nH]ccc3c2)nn1 |
| InChI | InChI=1S/C15H14N4O2/c1-21-15-5-4-13(18-19-15)17-14(20)9-10-2-3-12-11(8-10)6-7-16-12/h2-8,16H,9H2,1H3,(H,17,18,20) |
| InChIKey | RRLBVLAXPDVKKN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |