C6H7N3O3 — CID 68896091
(6-methoxypyridazin-3-yl)carbamic acid (PubChem CID 68896091) has the molecular formula C6H7N3O3 and a molecular weight of 169.14 g/mol. Its IUPAC name is (6-methoxypyridazin-3-yl)carbamic acid.
| Compound Name | (6-methoxypyridazin-3-yl)carbamic acid |
|---|---|
| PubChem CID | 68896091 |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | (6-methoxypyridazin-3-yl)carbamic acid |
| SMILES | COc1ccc(NC(=O)O)nn1 |
| InChI | InChI=1S/C6H7N3O3/c1-12-5-3-2-4(8-9-5)7-6(10)11/h2-3H,1H3,(H,7,8)(H,10,11) |
| InChIKey | WWRSQOQMOMNEBU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |