C6H11BN2O5 — CID 139090617
boric acid;3,6-dimethoxypyridazine (PubChem CID 139090617) has the molecular formula C6H11BN2O5 and a molecular weight of 201.97 g/mol. Its IUPAC name is boric acid;3,6-dimethoxypyridazine.
| Compound Name | boric acid;3,6-dimethoxypyridazine |
|---|---|
| PubChem CID | 139090617 |
| Molecular Formula | C6H11BN2O5 |
| Molecular Weight | 201.97 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | boric acid;3,6-dimethoxypyridazine |
| SMILES | COc1ccc(OC)nn1.OB(O)O |
| InChI | InChI=1S/C6H8N2O2.BH3O3/c1-9-5-3-4-6(10-2)8-7-5;2-1(3)4/h3-4H,1-2H3;2-4H |
| InChIKey | XBSYTIMXOZAYCN-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.97 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|