C10H15N3O — CID 103374177
1-(6-methoxypyridazin-3-yl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 103374177) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-(6-methoxypyridazin-3-yl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 1-(6-methoxypyridazin-3-yl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103374177 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 1-(6-methoxypyridazin-3-yl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)C(NC)c1ccc(OC)nn1 |
| InChI | InChI=1S/C10H15N3O/c1-7(2)10(11-3)8-5-6-9(14-4)13-12-8/h5-6,10-11H,1H2,2-4H3 |
| InChIKey | IJWGPISUCMUCDC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|