C12H16ClNO — CID 105005229
1-(5-chloro-2-methoxyphenyl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 105005229) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 105005229 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)C(NC)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C12H16ClNO/c1-8(2)12(14-3)10-7-9(13)5-6-11(10)15-4/h5-7,12,14H,1H2,2-4H3 |
| InChIKey | XSLAULOHKIRGIK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|