C12H14N2O2 — CID 59248610
ethyl N-(1H-indol-5-ylmethyl)carbamate (PubChem CID 59248610) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is ethyl N-(1H-indol-5-ylmethyl)carbamate.
| Compound Name | ethyl N-(1H-indol-5-ylmethyl)carbamate |
|---|---|
| PubChem CID | 59248610 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | ethyl N-(1H-indol-5-ylmethyl)carbamate |
| SMILES | CCOC(=O)NCc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C12H14N2O2/c1-2-16-12(15)14-8-9-3-4-11-10(7-9)5-6-13-11/h3-7,13H,2,8H2,1H3,(H,14,15) |
| InChIKey | YQHBERKCZOALHV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |