C25H22FNO3 — CID 22559002
methyl 3-[4-[(4-fluorophenyl)methoxy]-3-(1H-indol-5-yl)phenyl]propanoate (PubChem CID 22559002) has the molecular formula C25H22FNO3 and a molecular weight of 403.45 g/mol. Its IUPAC name is methyl 3-[4-[(4-fluorophenyl)methoxy]-3-(1H-indol-5-yl)phenyl]propanoate.
| Compound Name | methyl 3-[4-[(4-fluorophenyl)methoxy]-3-(1H-indol-5-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 22559002 |
| Molecular Formula | C25H22FNO3 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | methyl 3-[4-[(4-fluorophenyl)methoxy]-3-(1H-indol-5-yl)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCc2ccc(F)cc2)c(-c2ccc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C25H22FNO3/c1-29-25(28)11-5-17-4-10-24(30-16-18-2-7-21(26)8-3-18)22(14-17)19-6-9-23-20(15-19)12-13-27-23/h2-4,6-10,12-15,27H,5,11,16H2,1H3 |
| InChIKey | YHLOSERZCOKVMT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |