C23H25NO3 — CID 22559146
3-[3-(1H-indol-5-yl)-4-(3-methylcyclopentyl)oxyphenyl]propanoic acid (PubChem CID 22559146) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-[3-(1H-indol-5-yl)-4-(3-methylcyclopentyl)oxyphenyl]propanoic acid.
| Compound Name | 3-[3-(1H-indol-5-yl)-4-(3-methylcyclopentyl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 22559146 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 3-[3-(1H-indol-5-yl)-4-(3-methylcyclopentyl)oxyphenyl]propanoic acid |
| SMILES | CC1CCC(Oc2ccc(CCC(=O)O)cc2-c2ccc3[nH]ccc3c2)C1 |
| InChI | InChI=1S/C23H25NO3/c1-15-2-6-19(12-15)27-22-8-3-16(4-9-23(25)26)13-20(22)17-5-7-21-18(14-17)10-11-24-21/h3,5,7-8,10-11,13-15,19,24H,2,4,6,9,12H2,1H3,(H,25,26) |
| InChIKey | FDJWBSQJANGQNN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |