C24H28N2O3 — CID 22559270
3-[4-cycloheptyloxy-3-(1-methylindazol-5-yl)phenyl]propanoic acid (PubChem CID 22559270) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-[4-cycloheptyloxy-3-(1-methylindazol-5-yl)phenyl]propanoic acid.
| Compound Name | 3-[4-cycloheptyloxy-3-(1-methylindazol-5-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 22559270 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3-[4-cycloheptyloxy-3-(1-methylindazol-5-yl)phenyl]propanoic acid |
| SMILES | Cn1ncc2cc(-c3cc(CCC(=O)O)ccc3OC3CCCCCC3)ccc21 |
| InChI | InChI=1S/C24H28N2O3/c1-26-22-11-10-18(15-19(22)16-25-26)21-14-17(9-13-24(27)28)8-12-23(21)29-20-6-4-2-3-5-7-20/h8,10-12,14-16,20H,2-7,9,13H2,1H3,(H,27,28) |
| InChIKey | ZPATZIRDLFDLLQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |