C24H27NO3 — CID 22558657
3-[4-cycloheptyloxy-3-(1H-indol-5-yl)phenyl]propanoic acid (PubChem CID 22558657) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 3-[4-cycloheptyloxy-3-(1H-indol-5-yl)phenyl]propanoic acid.
| Compound Name | 3-[4-cycloheptyloxy-3-(1H-indol-5-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 22558657 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 3-[4-cycloheptyloxy-3-(1H-indol-5-yl)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OC2CCCCCC2)c(-c2ccc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C24H27NO3/c26-24(27)12-8-17-7-11-23(28-20-5-3-1-2-4-6-20)21(15-17)18-9-10-22-19(16-18)13-14-25-22/h7,9-11,13-16,20,25H,1-6,8,12H2,(H,26,27) |
| InChIKey | QZLRZWJASDEWQT-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |