C26H29NO3 — CID 22558753
methyl 3-[4-(2-bicyclo[2.2.1]heptanylmethoxy)-3-(1H-indol-5-yl)phenyl]propanoate (PubChem CID 22558753) has the molecular formula C26H29NO3 and a molecular weight of 403.52 g/mol. Its IUPAC name is methyl 3-[4-(2-bicyclo[2.2.1]heptanylmethoxy)-3-(1H-indol-5-yl)phenyl]propanoate.
| Compound Name | methyl 3-[4-(2-bicyclo[2.2.1]heptanylmethoxy)-3-(1H-indol-5-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 22558753 |
| Molecular Formula | C26H29NO3 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | methyl 3-[4-(2-bicyclo[2.2.1]heptanylmethoxy)-3-(1H-indol-5-yl)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCC2CC3CCC2C3)c(-c2ccc3[nH]ccc3c2)c1 |
| InChI | InChI=1S/C26H29NO3/c1-29-26(28)9-4-17-3-8-25(30-16-22-13-18-2-5-19(22)12-18)23(14-17)20-6-7-24-21(15-20)10-11-27-24/h3,6-8,10-11,14-15,18-19,22,27H,2,4-5,9,12-13,16H2,1H3 |
| InChIKey | MXJAHHJODLCRBA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |