C29H32ClNO5 — CID 22558618
methyl 3-[3-[6-(2-chloroethoxycarbonylamino)naphthalen-2-yl]-4-(cyclopentylmethoxy)phenyl]propanoate (PubChem CID 22558618) has the molecular formula C29H32ClNO5 and a molecular weight of 510.03 g/mol. Its IUPAC name is methyl 3-[3-[6-(2-chloroethoxycarbonylamino)naphthalen-2-yl]-4-(cyclopentylmethoxy)phenyl]propanoate.
| Compound Name | methyl 3-[3-[6-(2-chloroethoxycarbonylamino)naphthalen-2-yl]-4-(cyclopentylmethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 22558618 |
| Molecular Formula | C29H32ClNO5 |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | methyl 3-[3-[6-(2-chloroethoxycarbonylamino)naphthalen-2-yl]-4-(cyclopentylmethoxy)phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCC2CCCC2)c(-c2ccc3cc(NC(=O)OCCCl)ccc3c2)c1 |
| InChI | InChI=1S/C29H32ClNO5/c1-34-28(32)13-7-20-6-12-27(36-19-21-4-2-3-5-21)26(16-20)24-9-8-23-18-25(11-10-22(23)17-24)31-29(33)35-15-14-30/h6,8-12,16-18,21H,2-5,7,13-15,19H2,1H3,(H,31,33) |
| InChIKey | GZTFOYTUDMWNCN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|