C23H29NO3 — CID 22616595
methyl 3-[3-amino-4-(cyclohexylmethoxy)-5-phenylphenyl]propanoate (PubChem CID 22616595) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is methyl 3-[3-amino-4-(cyclohexylmethoxy)-5-phenylphenyl]propanoate.
| Compound Name | methyl 3-[3-amino-4-(cyclohexylmethoxy)-5-phenylphenyl]propanoate |
|---|---|
| PubChem CID | 22616595 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | methyl 3-[3-amino-4-(cyclohexylmethoxy)-5-phenylphenyl]propanoate |
| SMILES | COC(=O)CCc1cc(N)c(OCC2CCCCC2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C23H29NO3/c1-26-22(25)13-12-18-14-20(19-10-6-3-7-11-19)23(21(24)15-18)27-16-17-8-4-2-5-9-17/h3,6-7,10-11,14-15,17H,2,4-5,8-9,12-13,16,24H2,1H3 |
| InChIKey | UVKPKINGJZRNIP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|