C24H26N2O5 — CID 68826720
3-[4-(cyclopentylmethoxy)-3-(1-methylindol-5-yl)-5-nitrophenyl]propanoic acid (PubChem CID 68826720) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 3-[4-(cyclopentylmethoxy)-3-(1-methylindol-5-yl)-5-nitrophenyl]propanoic acid.
| Compound Name | 3-[4-(cyclopentylmethoxy)-3-(1-methylindol-5-yl)-5-nitrophenyl]propanoic acid |
|---|---|
| PubChem CID | 68826720 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-[4-(cyclopentylmethoxy)-3-(1-methylindol-5-yl)-5-nitrophenyl]propanoic acid |
| SMILES | Cn1ccc2cc(-c3cc(CCC(=O)O)cc([N+](=O)[O-])c3OCC3CCCC3)ccc21 |
| InChI | InChI=1S/C24H26N2O5/c1-25-11-10-19-14-18(7-8-21(19)25)20-12-17(6-9-23(27)28)13-22(26(29)30)24(20)31-15-16-4-2-3-5-16/h7-8,10-14,16H,2-6,9,15H2,1H3,(H,27,28) |
| InChIKey | GFHCUQFDNLWSFQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|