C26H31NO4 — CID 24776391
2-[(1S)-5-[3-(1-methyl-4-propylindol-5-yl)oxypropoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 24776391) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[(1S)-5-[3-(1-methyl-4-propylindol-5-yl)oxypropoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-(1-methyl-4-propylindol-5-yl)oxypropoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 24776391 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 2-[(1S)-5-[3-(1-methyl-4-propylindol-5-yl)oxypropoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | CCCc1c(OCCCOc2ccc3c(c2)CC[C@H]3CC(=O)O)ccc2c1ccn2C |
| InChI | InChI=1S/C26H31NO4/c1-3-5-23-22-12-13-27(2)24(22)10-11-25(23)31-15-4-14-30-20-8-9-21-18(16-20)6-7-19(21)17-26(28)29/h8-13,16,19H,3-7,14-15,17H2,1-2H3,(H,28,29)/t19-/m0/s1 |
| InChIKey | IJQXLXIHFZMCIG-IBGZPJMESA-N |
| XLogP | 5.48 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|