C23H25NO4 — CID 24776389
2-[(1S)-5-[3-[(4-methyl-1H-indol-5-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid (PubChem CID 24776389) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[(1S)-5-[3-[(4-methyl-1H-indol-5-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid.
| Compound Name | 2-[(1S)-5-[3-[(4-methyl-1H-indol-5-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
|---|---|
| PubChem CID | 24776389 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[(1S)-5-[3-[(4-methyl-1H-indol-5-yl)oxy]propoxy]-2,3-dihydro-1H-inden-1-yl]acetic acid |
| SMILES | Cc1c(OCCCOc2ccc3c(c2)CC[C@H]3CC(=O)O)ccc2[nH]ccc12 |
| InChI | InChI=1S/C23H25NO4/c1-15-19-9-10-24-21(19)7-8-22(15)28-12-2-11-27-18-5-6-20-16(13-18)3-4-17(20)14-23(25)26/h5-10,13,17,24H,2-4,11-12,14H2,1H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | BYCAERLPWMCTIO-KRWDZBQOSA-N |
| XLogP | 4.83 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|