C26H21F3N2O5 — CID 22558868
methyl 3-[3-(1H-indol-5-yl)-5-nitro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoate (PubChem CID 22558868) has the molecular formula C26H21F3N2O5 and a molecular weight of 498.46 g/mol. Its IUPAC name is methyl 3-[3-(1H-indol-5-yl)-5-nitro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-[3-(1H-indol-5-yl)-5-nitro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 22558868 |
| Molecular Formula | C26H21F3N2O5 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | methyl 3-[3-(1H-indol-5-yl)-5-nitro-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1cc(-c2ccc3[nH]ccc3c2)c(OCc2ccc(C(F)(F)F)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H21F3N2O5/c1-35-24(32)9-4-17-12-21(18-5-8-22-19(14-18)10-11-30-22)25(23(13-17)31(33)34)36-15-16-2-6-20(7-3-16)26(27,28)29/h2-3,5-8,10-14,30H,4,9,15H2,1H3 |
| InChIKey | UJTYTMZDOXBKGW-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|