C24H22N2O3 — CID 139561659
2-[2-[[4-[3-(aminomethyl)phenyl]-1H-indol-6-yl]methoxy]phenyl]acetic acid (PubChem CID 139561659) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-[2-[[4-[3-(aminomethyl)phenyl]-1H-indol-6-yl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[4-[3-(aminomethyl)phenyl]-1H-indol-6-yl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 139561659 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-[2-[[4-[3-(aminomethyl)phenyl]-1H-indol-6-yl]methoxy]phenyl]acetic acid |
| SMILES | NCc1cccc(-c2cc(COc3ccccc3CC(=O)O)cc3[nH]ccc23)c1 |
| InChI | InChI=1S/C24H22N2O3/c25-14-16-4-3-6-18(10-16)21-11-17(12-22-20(21)8-9-26-22)15-29-23-7-2-1-5-19(23)13-24(27)28/h1-12,26H,13-15,25H2,(H,27,28) |
| InChIKey | KVGULRWMPIAFKB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |