C22H25NO3 — CID 7854658
cyclohexylmethyl 2-[(4-phenylbenzoyl)amino]acetate (PubChem CID 7854658) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is cyclohexylmethyl 2-[(4-phenylbenzoyl)amino]acetate.
| Compound Name | cyclohexylmethyl 2-[(4-phenylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7854658 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | cyclohexylmethyl 2-[(4-phenylbenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc(-c2ccccc2)cc1)OCC1CCCCC1 |
| InChI | InChI=1S/C22H25NO3/c24-21(26-16-17-7-3-1-4-8-17)15-23-22(25)20-13-11-19(12-14-20)18-9-5-2-6-10-18/h2,5-6,9-14,17H,1,3-4,7-8,15-16H2,(H,23,25) |
| InChIKey | LJXROPNXKVKANB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |