C29H29NO3 — CID 22558773
methyl 3-[3-amino-4-[2-(4-methylphenyl)ethoxy]-5-naphthalen-2-ylphenyl]propanoate (PubChem CID 22558773) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is methyl 3-[3-amino-4-[2-(4-methylphenyl)ethoxy]-5-naphthalen-2-ylphenyl]propanoate.
| Compound Name | methyl 3-[3-amino-4-[2-(4-methylphenyl)ethoxy]-5-naphthalen-2-ylphenyl]propanoate |
|---|---|
| PubChem CID | 22558773 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | methyl 3-[3-amino-4-[2-(4-methylphenyl)ethoxy]-5-naphthalen-2-ylphenyl]propanoate |
| SMILES | COC(=O)CCc1cc(N)c(OCCc2ccc(C)cc2)c(-c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C29H29NO3/c1-20-7-9-21(10-8-20)15-16-33-29-26(17-22(18-27(29)30)11-14-28(31)32-2)25-13-12-23-5-3-4-6-24(23)19-25/h3-10,12-13,17-19H,11,14-16,30H2,1-2H3 |
| InChIKey | ONBAJAARNKOAII-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|