C26H27NO5 — CID 22558933
methyl 3-[4-(2-methylcyclopentyl)oxy-3-naphthalen-2-yl-5-nitrophenyl]propanoate (PubChem CID 22558933) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is methyl 3-[4-(2-methylcyclopentyl)oxy-3-naphthalen-2-yl-5-nitrophenyl]propanoate.
| Compound Name | methyl 3-[4-(2-methylcyclopentyl)oxy-3-naphthalen-2-yl-5-nitrophenyl]propanoate |
|---|---|
| PubChem CID | 22558933 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | methyl 3-[4-(2-methylcyclopentyl)oxy-3-naphthalen-2-yl-5-nitrophenyl]propanoate |
| SMILES | COC(=O)CCc1cc(-c2ccc3ccccc3c2)c(OC2CCCC2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H27NO5/c1-17-6-5-9-24(17)32-26-22(21-12-11-19-7-3-4-8-20(19)16-21)14-18(10-13-25(28)31-2)15-23(26)27(29)30/h3-4,7-8,11-12,14-17,24H,5-6,9-10,13H2,1-2H3 |
| InChIKey | AZJGPNASLGGAQY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|