C25H28N2O5 — CID 22558946
methyl 3-[4-cyclopentyloxy-3-(1-ethylindol-5-yl)-5-nitrophenyl]propanoate (PubChem CID 22558946) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 3-[4-cyclopentyloxy-3-(1-ethylindol-5-yl)-5-nitrophenyl]propanoate.
| Compound Name | methyl 3-[4-cyclopentyloxy-3-(1-ethylindol-5-yl)-5-nitrophenyl]propanoate |
|---|---|
| PubChem CID | 22558946 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | methyl 3-[4-cyclopentyloxy-3-(1-ethylindol-5-yl)-5-nitrophenyl]propanoate |
| SMILES | CCn1ccc2cc(-c3cc(CCC(=O)OC)cc([N+](=O)[O-])c3OC3CCCC3)ccc21 |
| InChI | InChI=1S/C25H28N2O5/c1-3-26-13-12-19-16-18(9-10-22(19)26)21-14-17(8-11-24(28)31-2)15-23(27(29)30)25(21)32-20-6-4-5-7-20/h9-10,12-16,20H,3-8,11H2,1-2H3 |
| InChIKey | IZKBACZNWOEQOA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|