C21H25NO5 — CID 22616629
methyl 4-(4-butoxy-3-nitro-5-phenylphenyl)butanoate (PubChem CID 22616629) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is methyl 4-(4-butoxy-3-nitro-5-phenylphenyl)butanoate.
| Compound Name | methyl 4-(4-butoxy-3-nitro-5-phenylphenyl)butanoate |
|---|---|
| PubChem CID | 22616629 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | methyl 4-(4-butoxy-3-nitro-5-phenylphenyl)butanoate |
| SMILES | CCCCOc1c(-c2ccccc2)cc(CCCC(=O)OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H25NO5/c1-3-4-13-27-21-18(17-10-6-5-7-11-17)14-16(15-19(21)22(24)25)9-8-12-20(23)26-2/h5-7,10-11,14-15H,3-4,8-9,12-13H2,1-2H3 |
| InChIKey | OGMUOEWFFWXECN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|