C14H19ClN2O6 — CID 175492877
methyl 5-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-5-oxopentanoate;hydrochloride (PubChem CID 175492877) has the molecular formula C14H19ClN2O6 and a molecular weight of 346.77 g/mol. Its IUPAC name is methyl 5-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-5-oxopentanoate;hydrochloride.
| Compound Name | methyl 5-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-5-oxopentanoate;hydrochloride |
|---|---|
| PubChem CID | 175492877 |
| Molecular Formula | C14H19ClN2O6 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | methyl 5-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-5-oxopentanoate;hydrochloride |
| SMILES | COC(=O)CCCC(=O)NCc1ccc(CO)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C14H18N2O6.ClH/c1-22-14(19)4-2-3-13(18)15-8-10-5-6-11(9-17)12(7-10)16(20)21;/h5-7,17H,2-4,8-9H2,1H3,(H,15,18);1H |
| InChIKey | ACTMMNJXYDGPPK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|