C17H19N3O6S2 — CID 156697513
3-[2-(2,5-dioxopyrrol-1-yl)ethyldisulfanyl]-N-[[4-(hydroxymethyl)-3-nitrophenyl]methyl]propanamide (PubChem CID 156697513) has the molecular formula C17H19N3O6S2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-[2-(2,5-dioxopyrrol-1-yl)ethyldisulfanyl]-N-[[4-(hydroxymethyl)-3-nitrophenyl]methyl]propanamide.
| Compound Name | 3-[2-(2,5-dioxopyrrol-1-yl)ethyldisulfanyl]-N-[[4-(hydroxymethyl)-3-nitrophenyl]methyl]propanamide |
|---|---|
| PubChem CID | 156697513 |
| Molecular Formula | C17H19N3O6S2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 3-[2-(2,5-dioxopyrrol-1-yl)ethyldisulfanyl]-N-[[4-(hydroxymethyl)-3-nitrophenyl]methyl]propanamide |
| SMILES | O=C(CCSSCCN1C(=O)C=CC1=O)NCc1ccc(CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19N3O6S2/c21-11-13-2-1-12(9-14(13)20(25)26)10-18-15(22)5-7-27-28-8-6-19-16(23)3-4-17(19)24/h1-4,9,21H,5-8,10-11H2,(H,18,22) |
| InChIKey | TWXSNZGVYCRZRY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|